C23H24OSSi — CID 10904910
(4E)-4-benzylidene-7-phenylsulfanyl-1-trimethylsilylhepta-1,5-diyn-3-ol (PubChem CID 10904910) has the molecular formula C23H24OSSi and a molecular weight of 376.60 g/mol. Its IUPAC name is (4E)-4-benzylidene-7-phenylsulfanyl-1-trimethylsilylhepta-1,5-diyn-3-ol.
| Compound Name | (4E)-4-benzylidene-7-phenylsulfanyl-1-trimethylsilylhepta-1,5-diyn-3-ol |
|---|---|
| PubChem CID | 10904910 |
| Molecular Formula | C23H24OSSi |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (4E)-4-benzylidene-7-phenylsulfanyl-1-trimethylsilylhepta-1,5-diyn-3-ol |
| SMILES | C[Si](C)(C)C#CC(O)/C(C#CCSc1ccccc1)=C/c1ccccc1 |
| InChI | InChI=1S/C23H24OSSi/c1-26(2,3)18-16-23(24)21(19-20-11-6-4-7-12-20)13-10-17-25-22-14-8-5-9-15-22/h4-9,11-12,14-15,19,23-24H,17H2,1-3H3/b21-19+ |
| InChIKey | JJMLHBDSSCGBLM-XUTLUUPISA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|