C25H26O2S — CID 15891794
(2E)-8-methoxy-1-phenyl-2-(4-phenylsulfanylbut-2-ynylidene)oct-3-yn-1-ol (PubChem CID 15891794) has the molecular formula C25H26O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is (2E)-8-methoxy-1-phenyl-2-(4-phenylsulfanylbut-2-ynylidene)oct-3-yn-1-ol.
| Compound Name | (2E)-8-methoxy-1-phenyl-2-(4-phenylsulfanylbut-2-ynylidene)oct-3-yn-1-ol |
|---|---|
| PubChem CID | 15891794 |
| Molecular Formula | C25H26O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (2E)-8-methoxy-1-phenyl-2-(4-phenylsulfanylbut-2-ynylidene)oct-3-yn-1-ol |
| SMILES | COCCCCC#C/C(=C\C#CCSc1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C25H26O2S/c1-27-20-12-3-2-6-14-23(25(26)22-15-7-4-8-16-22)17-11-13-21-28-24-18-9-5-10-19-24/h4-5,7-10,15-19,25-26H,2-3,12,20-21H2,1H3/b23-17+ |
| InChIKey | DNRAZMVGSJDTOH-HAVVHWLPSA-N |
| XLogP | 5.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|