C21H34OSSi — CID 134977248
tert-butyl-dimethyl-(9-phenylsulfanylnon-5-ynoxy)silane (PubChem CID 134977248) has the molecular formula C21H34OSSi and a molecular weight of 362.66 g/mol. Its IUPAC name is tert-butyl-dimethyl-(9-phenylsulfanylnon-5-ynoxy)silane.
| Compound Name | tert-butyl-dimethyl-(9-phenylsulfanylnon-5-ynoxy)silane |
|---|---|
| PubChem CID | 134977248 |
| Molecular Formula | C21H34OSSi |
| Molecular Weight | 362.66 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | tert-butyl-dimethyl-(9-phenylsulfanylnon-5-ynoxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC#CCCCSc1ccccc1 |
| InChI | InChI=1S/C21H34OSSi/c1-21(2,3)24(4,5)22-18-14-9-7-6-8-10-15-19-23-20-16-12-11-13-17-20/h11-13,16-17H,7,9-10,14-15,18-19H2,1-5H3 |
| InChIKey | NTWOBSFLPXYEFV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.66 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|