C38H74BO3Si3- — CID 135048483
tris[4-[tert-butyl(dimethyl)silyl]oxybutyl]-(2-phenylethynyl)boranuide (PubChem CID 135048483) has the molecular formula C38H74BO3Si3- and a molecular weight of 674.08 g/mol. Its IUPAC name is tris[4-[tert-butyl(dimethyl)silyl]oxybutyl]-(2-phenylethynyl)boranuide.
| Compound Name | tris[4-[tert-butyl(dimethyl)silyl]oxybutyl]-(2-phenylethynyl)boranuide |
|---|---|
| PubChem CID | 135048483 |
| Molecular Formula | C38H74BO3Si3- |
| Molecular Weight | 674.08 g/mol |
| Exact Mass | 673.50 |
| IUPAC Name | tris[4-[tert-butyl(dimethyl)silyl]oxybutyl]-(2-phenylethynyl)boranuide |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC[B-](C#Cc1ccccc1)(CCCCO[Si](C)(C)C(C)(C)C)CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H74BO3Si3/c1-36(2,3)43(10,11)40-32-22-19-28-39(31-27-35-25-17-16-18-26-35,29-20-23-33-41-44(12,13)37(4,5)6)30-21-24-34-42-45(14,15)38(7,8)9/h16-18,25-26H,19-24,28-30,32-34H2,1-15H3/q-1 |
| InChIKey | VHSJLDICQVJWEU-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.08 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|