C19H28O2Si — CID 46848785
7-[tert-butyl(dimethyl)silyl]oxy-1-phenylhept-1-yn-3-one (PubChem CID 46848785) has the molecular formula C19H28O2Si and a molecular weight of 316.52 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxy-1-phenylhept-1-yn-3-one.
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxy-1-phenylhept-1-yn-3-one |
|---|---|
| PubChem CID | 46848785 |
| Molecular Formula | C19H28O2Si |
| Molecular Weight | 316.52 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxy-1-phenylhept-1-yn-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC(=O)C#Cc1ccccc1 |
| InChI | InChI=1S/C19H28O2Si/c1-19(2,3)22(4,5)21-16-10-9-13-18(20)15-14-17-11-7-6-8-12-17/h6-8,11-12H,9-10,13,16H2,1-5H3 |
| InChIKey | DXDMIFMVRRKNMR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|