C24H34OSSeSi — CID 11374991
tert-butyl-dimethyl-[(Z)-6-phenylselanyl-5-phenylsulfanylhex-5-enoxy]silane (PubChem CID 11374991) has the molecular formula C24H34OSSeSi and a molecular weight of 477.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z)-6-phenylselanyl-5-phenylsulfanylhex-5-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z)-6-phenylselanyl-5-phenylsulfanylhex-5-enoxy]silane |
|---|---|
| PubChem CID | 11374991 |
| Molecular Formula | C24H34OSSeSi |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | tert-butyl-dimethyl-[(Z)-6-phenylselanyl-5-phenylsulfanylhex-5-enoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC/C(=C/[Se]c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C24H34OSSeSi/c1-24(2,3)28(4,5)25-19-13-12-16-22(26-21-14-8-6-9-15-21)20-27-23-17-10-7-11-18-23/h6-11,14-15,17-18,20H,12-13,16,19H2,1-5H3/b22-20- |
| InChIKey | HYQOTKKYIXBSLX-XDOYNYLZSA-N |
| XLogP | 6.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|