C12H23BF3KOSi — CID 23696339
potassium 6-[tert-butyl(dimethyl)silyl]oxyhex-1-ynyl-trifluoroboranuide (PubChem CID 23696339) has the molecular formula C12H23BF3KOSi and a molecular weight of 318.31 g/mol. Its IUPAC name is potassium 6-[tert-butyl(dimethyl)silyl]oxyhex-1-ynyl-trifluoroboranuide.
| Compound Name | potassium 6-[tert-butyl(dimethyl)silyl]oxyhex-1-ynyl-trifluoroboranuide |
|---|---|
| PubChem CID | 23696339 |
| Molecular Formula | C12H23BF3KOSi |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | potassium 6-[tert-butyl(dimethyl)silyl]oxyhex-1-ynyl-trifluoroboranuide |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC#C[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C12H23BF3OSi.K/c1-12(2,3)18(4,5)17-11-9-7-6-8-10-13(14,15)16;/h6-7,9,11H2,1-5H3;/q-1;+1 |
| InChIKey | MZVZLORWYLMIGR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|