C16H29ClOSi — CID 87614824
tert-butyl-[(Z)-10-chlorodec-9-en-7-ynoxy]-dimethylsilane (PubChem CID 87614824) has the molecular formula C16H29ClOSi and a molecular weight of 300.95 g/mol. Its IUPAC name is tert-butyl-[(Z)-10-chlorodec-9-en-7-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-10-chlorodec-9-en-7-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 87614824 |
| Molecular Formula | C16H29ClOSi |
| Molecular Weight | 300.95 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | tert-butyl-[(Z)-10-chlorodec-9-en-7-ynoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCC#C/C=C\Cl |
| InChI | InChI=1S/C16H29ClOSi/c1-16(2,3)19(4,5)18-15-13-11-9-7-6-8-10-12-14-17/h12,14H,6-7,9,11,13,15H2,1-5H3/b14-12- |
| InChIKey | FNPQAFXQSJPXTH-OWBHPGMISA-N |
| XLogP | 5.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.95 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|