C15H25ClOSSi — CID 141310434
tert-butyl-[3-(2-chlorophenyl)sulfanylpropoxy]-dimethylsilane (PubChem CID 141310434) has the molecular formula C15H25ClOSSi and a molecular weight of 316.97 g/mol. Its IUPAC name is tert-butyl-[3-(2-chlorophenyl)sulfanylpropoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-(2-chlorophenyl)sulfanylpropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 141310434 |
| Molecular Formula | C15H25ClOSSi |
| Molecular Weight | 316.97 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | tert-butyl-[3-(2-chlorophenyl)sulfanylpropoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCSc1ccccc1Cl |
| InChI | InChI=1S/C15H25ClOSSi/c1-15(2,3)19(4,5)17-11-8-12-18-14-10-7-6-9-13(14)16/h6-7,9-10H,8,11-12H2,1-5H3 |
| InChIKey | SUMIPPZCOQXRAK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.97 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|