C27H46O4SSi2 — CID 10414415
2-trimethylsilylethyl (2Z)-2-[[2-[5-[tert-butyl(dimethyl)silyl]oxypentylsulfanyl]phenyl]methylidene]-3-oxobutanoate (PubChem CID 10414415) has the molecular formula C27H46O4SSi2 and a molecular weight of 522.90 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2Z)-2-[[2-[5-[tert-butyl(dimethyl)silyl]oxypentylsulfanyl]phenyl]methylidene]-3-oxobutanoate.
| Compound Name | 2-trimethylsilylethyl (2Z)-2-[[2-[5-[tert-butyl(dimethyl)silyl]oxypentylsulfanyl]phenyl]methylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 10414415 |
| Molecular Formula | C27H46O4SSi2 |
| Molecular Weight | 522.90 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 2-trimethylsilylethyl (2Z)-2-[[2-[5-[tert-butyl(dimethyl)silyl]oxypentylsulfanyl]phenyl]methylidene]-3-oxobutanoate |
| SMILES | CC(=O)/C(=C/c1ccccc1SCCCCCO[Si](C)(C)C(C)(C)C)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C27H46O4SSi2/c1-22(28)24(26(29)30-18-20-33(5,6)7)21-23-15-11-12-16-25(23)32-19-14-10-13-17-31-34(8,9)27(2,3)4/h11-12,15-16,21H,10,13-14,17-20H2,1-9H3/b24-21- |
| InChIKey | PGCYXGOYMNOZFX-FLFQWRMESA-N |
| XLogP | 7.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.90 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|