C27H45NO6SSi2 — CID 10370735
2-trimethylsilylethyl (2Z)-2-[[2-[5-[tert-butyl(dimethyl)silyl]oxypentylsulfanyl]-3-nitrophenyl]methylidene]-3-oxobutanoate (PubChem CID 10370735) has the molecular formula C27H45NO6SSi2 and a molecular weight of 567.90 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2Z)-2-[[2-[5-[tert-butyl(dimethyl)silyl]oxypentylsulfanyl]-3-nitrophenyl]methylidene]-3-oxobutanoate.
| Compound Name | 2-trimethylsilylethyl (2Z)-2-[[2-[5-[tert-butyl(dimethyl)silyl]oxypentylsulfanyl]-3-nitrophenyl]methylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 10370735 |
| Molecular Formula | C27H45NO6SSi2 |
| Molecular Weight | 567.90 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | 2-trimethylsilylethyl (2Z)-2-[[2-[5-[tert-butyl(dimethyl)silyl]oxypentylsulfanyl]-3-nitrophenyl]methylidene]-3-oxobutanoate |
| SMILES | CC(=O)/C(=C/c1cccc([N+](=O)[O-])c1SCCCCCO[Si](C)(C)C(C)(C)C)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C27H45NO6SSi2/c1-21(29)23(26(30)33-17-19-36(5,6)7)20-22-14-13-15-24(28(31)32)25(22)35-18-12-10-11-16-34-37(8,9)27(2,3)4/h13-15,20H,10-12,16-19H2,1-9H3/b23-20- |
| InChIKey | RZZOCLHPZHDHED-ATJXCDBQSA-N |
| XLogP | 7.73 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.90 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|