C27H28O3S — CID 100960434
[(2Z)-8-methoxy-1-phenyl-2-(4-phenylsulfanylbut-2-ynylidene)oct-3-ynyl] acetate (PubChem CID 100960434) has the molecular formula C27H28O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is [(2Z)-8-methoxy-1-phenyl-2-(4-phenylsulfanylbut-2-ynylidene)oct-3-ynyl] acetate.
| Compound Name | [(2Z)-8-methoxy-1-phenyl-2-(4-phenylsulfanylbut-2-ynylidene)oct-3-ynyl] acetate |
|---|---|
| PubChem CID | 100960434 |
| Molecular Formula | C27H28O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [(2Z)-8-methoxy-1-phenyl-2-(4-phenylsulfanylbut-2-ynylidene)oct-3-ynyl] acetate |
| SMILES | COCCCCC#C/C(=C/C#CCSc1ccccc1)C(OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C27H28O3S/c1-23(28)30-27(24-16-8-5-9-17-24)25(15-7-3-4-13-21-29-2)18-12-14-22-31-26-19-10-6-11-20-26/h5-6,8-11,16-20,27H,3-4,13,21-22H2,1-2H3/b25-18- |
| InChIKey | VECIRZUIDYFLFZ-BWAHOGKJSA-N |
| XLogP | 5.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|