C32H30O3S — CID 11145452
[(5E)-5-benzylidene-11-methoxy-1-phenylsulfanylundeca-2,6-diyn-4-yl] benzoate (PubChem CID 11145452) has the molecular formula C32H30O3S and a molecular weight of 494.66 g/mol. Its IUPAC name is [(5E)-5-benzylidene-11-methoxy-1-phenylsulfanylundeca-2,6-diyn-4-yl] benzoate.
| Compound Name | [(5E)-5-benzylidene-11-methoxy-1-phenylsulfanylundeca-2,6-diyn-4-yl] benzoate |
|---|---|
| PubChem CID | 11145452 |
| Molecular Formula | C32H30O3S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | [(5E)-5-benzylidene-11-methoxy-1-phenylsulfanylundeca-2,6-diyn-4-yl] benzoate |
| SMILES | COCCCCC#C/C(=C\c1ccccc1)C(C#CCSc1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H30O3S/c1-34-24-14-3-2-9-20-29(26-27-16-7-4-8-17-27)31(35-32(33)28-18-10-5-11-19-28)23-15-25-36-30-21-12-6-13-22-30/h4-8,10-13,16-19,21-22,26,31H,2-3,14,24-25H2,1H3/b29-26+ |
| InChIKey | KFMMZAVCPDQMNB-PBBVDAKRSA-N |
| XLogP | 6.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|