C26H28O2S — CID 15891796
[(5E)-5-benzylidene-4,11-dimethoxyundeca-2,6-diynyl]sulfanylbenzene (PubChem CID 15891796) has the molecular formula C26H28O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is [(5E)-5-benzylidene-4,11-dimethoxyundeca-2,6-diynyl]sulfanylbenzene.
| Compound Name | [(5E)-5-benzylidene-4,11-dimethoxyundeca-2,6-diynyl]sulfanylbenzene |
|---|---|
| PubChem CID | 15891796 |
| Molecular Formula | C26H28O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [(5E)-5-benzylidene-4,11-dimethoxyundeca-2,6-diynyl]sulfanylbenzene |
| SMILES | COCCCCC#C/C(=C\c1ccccc1)C(C#CCSc1ccccc1)OC |
| InChI | InChI=1S/C26H28O2S/c1-27-20-12-4-3-9-16-24(22-23-14-7-5-8-15-23)26(28-2)19-13-21-29-25-17-10-6-11-18-25/h5-8,10-11,14-15,17-18,22,26H,3-4,12,20-21H2,1-2H3/b24-22+ |
| InChIKey | DLHFNGTUOTVLRX-ZNTNEXAZSA-N |
| XLogP | 5.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|