C27H30O2S — CID 15891797
[(5E)-5-benzylidene-4-ethoxy-11-methoxyundeca-2,6-diynyl]sulfanylbenzene (PubChem CID 15891797) has the molecular formula C27H30O2S and a molecular weight of 418.60 g/mol. Its IUPAC name is [(5E)-5-benzylidene-4-ethoxy-11-methoxyundeca-2,6-diynyl]sulfanylbenzene.
| Compound Name | [(5E)-5-benzylidene-4-ethoxy-11-methoxyundeca-2,6-diynyl]sulfanylbenzene |
|---|---|
| PubChem CID | 15891797 |
| Molecular Formula | C27H30O2S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [(5E)-5-benzylidene-4-ethoxy-11-methoxyundeca-2,6-diynyl]sulfanylbenzene |
| SMILES | CCOC(C#CCSc1ccccc1)/C(C#CCCCCOC)=C/c1ccccc1 |
| InChI | InChI=1S/C27H30O2S/c1-3-29-27(20-14-22-30-26-18-11-7-12-19-26)25(17-10-4-5-13-21-28-2)23-24-15-8-6-9-16-24/h6-9,11-12,15-16,18-19,23,27H,3-5,13,21-22H2,1-2H3/b25-23+ |
| InChIKey | CRWQLEJZYQCVIA-WJTDDFOZSA-N |
| XLogP | 6.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|