C30H32O4S2 — CID 11005844
[(5E)-5-[[2-(acetylsulfanylmethyl)phenyl]methylidene]-11-methoxy-1-phenylsulfanylundeca-2,6-diyn-4-yl] acetate (PubChem CID 11005844) has the molecular formula C30H32O4S2 and a molecular weight of 520.72 g/mol. Its IUPAC name is [(5E)-5-[[2-(acetylsulfanylmethyl)phenyl]methylidene]-11-methoxy-1-phenylsulfanylundeca-2,6-diyn-4-yl] acetate.
| Compound Name | [(5E)-5-[[2-(acetylsulfanylmethyl)phenyl]methylidene]-11-methoxy-1-phenylsulfanylundeca-2,6-diyn-4-yl] acetate |
|---|---|
| PubChem CID | 11005844 |
| Molecular Formula | C30H32O4S2 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | [(5E)-5-[[2-(acetylsulfanylmethyl)phenyl]methylidene]-11-methoxy-1-phenylsulfanylundeca-2,6-diyn-4-yl] acetate |
| SMILES | COCCCCC#C/C(=C\c1ccccc1CSC(C)=O)C(C#CCSc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C30H32O4S2/c1-24(31)34-30(19-13-21-35-29-17-8-6-9-18-29)27(15-7-4-5-12-20-33-3)22-26-14-10-11-16-28(26)23-36-25(2)32/h6,8-11,14,16-18,22,30H,4-5,12,20-21,23H2,1-3H3/b27-22+ |
| InChIKey | YWSVTNVYODOUFP-HPNDGRJYSA-N |
| XLogP | 6.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|