C22H30Si2 — CID 11100223
trimethyl-[5-phenyl-3-(2-trimethylsilylethynyl)octa-3,7-dien-1-ynyl]silane (PubChem CID 11100223) has the molecular formula C22H30Si2 and a molecular weight of 350.65 g/mol. Its IUPAC name is trimethyl-[5-phenyl-3-(2-trimethylsilylethynyl)octa-3,7-dien-1-ynyl]silane.
| Compound Name | trimethyl-[5-phenyl-3-(2-trimethylsilylethynyl)octa-3,7-dien-1-ynyl]silane |
|---|---|
| PubChem CID | 11100223 |
| Molecular Formula | C22H30Si2 |
| Molecular Weight | 350.65 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | trimethyl-[5-phenyl-3-(2-trimethylsilylethynyl)octa-3,7-dien-1-ynyl]silane |
| SMILES | C=CCC(C=C(C#C[Si](C)(C)C)C#C[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H30Si2/c1-8-12-22(21-13-10-9-11-14-21)19-20(15-17-23(2,3)4)16-18-24(5,6)7/h8-11,13-14,19,22H,1,12H2,2-7H3 |
| InChIKey | NCJIHWFFGWCIQW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|