C20H18 — CID 66553425
[(3Z)-5-phenylocta-3,7-dien-1-ynyl]benzene (PubChem CID 66553425) has the molecular formula C20H18 and a molecular weight of 258.36 g/mol. Its IUPAC name is [(3Z)-5-phenylocta-3,7-dien-1-ynyl]benzene.
| Compound Name | [(3Z)-5-phenylocta-3,7-dien-1-ynyl]benzene |
|---|---|
| PubChem CID | 66553425 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | [(3Z)-5-phenylocta-3,7-dien-1-ynyl]benzene |
| SMILES | C=CCC(/C=C\C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18/c1-2-11-19(20-15-7-4-8-16-20)17-10-9-14-18-12-5-3-6-13-18/h2-8,10,12-13,15-17,19H,1,11H2/b17-10- |
| InChIKey | RRAWXIOMCRAYGL-YVLHZVERSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|