C19H17F3 — CID 71390384
1-(3-phenylhexa-1,5-dienyl)-4-(trifluoromethyl)benzene (PubChem CID 71390384) has the molecular formula C19H17F3 and a molecular weight of 302.34 g/mol. Its IUPAC name is 1-(3-phenylhexa-1,5-dienyl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(3-phenylhexa-1,5-dienyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 71390384 |
| Molecular Formula | C19H17F3 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-(3-phenylhexa-1,5-dienyl)-4-(trifluoromethyl)benzene |
| SMILES | C=CCC(C=Cc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H17F3/c1-2-6-16(17-7-4-3-5-8-17)12-9-15-10-13-18(14-11-15)19(20,21)22/h2-5,7-14,16H,1,6H2 |
| InChIKey | AKGHDJVGEWFYOT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|