C17H16F3N — CID 102383013
N-[1-[3-(trifluoromethyl)phenyl]but-3-enyl]aniline (PubChem CID 102383013) has the molecular formula C17H16F3N and a molecular weight of 291.32 g/mol. Its IUPAC name is N-[1-[3-(trifluoromethyl)phenyl]but-3-enyl]aniline.
| Compound Name | N-[1-[3-(trifluoromethyl)phenyl]but-3-enyl]aniline |
|---|---|
| PubChem CID | 102383013 |
| Molecular Formula | C17H16F3N |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-[1-[3-(trifluoromethyl)phenyl]but-3-enyl]aniline |
| SMILES | C=CCC(Nc1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3N/c1-2-7-16(21-15-10-4-3-5-11-15)13-8-6-9-14(12-13)17(18,19)20/h2-6,8-12,16,21H,1,7H2 |
| InChIKey | DQXWABIIXYCJBA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|