C22H28O2SSi — CID 101124008
(2R,3R)-1-phenylmethoxy-3-(phenylsulfanylmethyl)-5-trimethylsilylpent-4-yn-2-ol (PubChem CID 101124008) has the molecular formula C22H28O2SSi and a molecular weight of 384.62 g/mol. Its IUPAC name is (2R,3R)-1-phenylmethoxy-3-(phenylsulfanylmethyl)-5-trimethylsilylpent-4-yn-2-ol.
| Compound Name | (2R,3R)-1-phenylmethoxy-3-(phenylsulfanylmethyl)-5-trimethylsilylpent-4-yn-2-ol |
|---|---|
| PubChem CID | 101124008 |
| Molecular Formula | C22H28O2SSi |
| Molecular Weight | 384.62 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (2R,3R)-1-phenylmethoxy-3-(phenylsulfanylmethyl)-5-trimethylsilylpent-4-yn-2-ol |
| SMILES | C[Si](C)(C)C#C[C@@H](CSc1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C22H28O2SSi/c1-26(2,3)15-14-20(18-25-21-12-8-5-9-13-21)22(23)17-24-16-19-10-6-4-7-11-19/h4-13,20,22-23H,16-18H2,1-3H3/t20-,22-/m0/s1 |
| InChIKey | ILXSWAULJZQAGI-UNMCSNQZSA-N |
| XLogP | 4.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|