C22H28O2SSi — CID 101124009
(2S,3R)-1-phenylmethoxy-3-phenylsulfanyl-6-trimethylsilylhex-5-yn-2-ol (PubChem CID 101124009) has the molecular formula C22H28O2SSi and a molecular weight of 384.62 g/mol. Its IUPAC name is (2S,3R)-1-phenylmethoxy-3-phenylsulfanyl-6-trimethylsilylhex-5-yn-2-ol.
| Compound Name | (2S,3R)-1-phenylmethoxy-3-phenylsulfanyl-6-trimethylsilylhex-5-yn-2-ol |
|---|---|
| PubChem CID | 101124009 |
| Molecular Formula | C22H28O2SSi |
| Molecular Weight | 384.62 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (2S,3R)-1-phenylmethoxy-3-phenylsulfanyl-6-trimethylsilylhex-5-yn-2-ol |
| SMILES | C[Si](C)(C)C#CC[C@@H](Sc1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C22H28O2SSi/c1-26(2,3)16-10-15-22(25-20-13-8-5-9-14-20)21(23)18-24-17-19-11-6-4-7-12-19/h4-9,11-14,21-23H,15,17-18H2,1-3H3/t21-,22+/m0/s1 |
| InChIKey | YBPCMCGFVWYQFG-FCHUYYIVSA-N |
| XLogP | 5.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|