C17H20O3S — CID 11130512
(2R,3R)-1-phenylmethoxy-4-phenylsulfanylbutane-2,3-diol (PubChem CID 11130512) has the molecular formula C17H20O3S and a molecular weight of 304.41 g/mol. Its IUPAC name is (2R,3R)-1-phenylmethoxy-4-phenylsulfanylbutane-2,3-diol.
| Compound Name | (2R,3R)-1-phenylmethoxy-4-phenylsulfanylbutane-2,3-diol |
|---|---|
| PubChem CID | 11130512 |
| Molecular Formula | C17H20O3S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (2R,3R)-1-phenylmethoxy-4-phenylsulfanylbutane-2,3-diol |
| SMILES | O[C@H](COCc1ccccc1)[C@@H](O)CSc1ccccc1 |
| InChI | InChI=1S/C17H20O3S/c18-16(12-20-11-14-7-3-1-4-8-14)17(19)13-21-15-9-5-2-6-10-15/h1-10,16-19H,11-13H2/t16-,17+/m1/s1 |
| InChIKey | OCVOQEIDWMANBG-SJORKVTESA-N |
| XLogP | 2.72 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |