C19H22O3S — CID 10860500
(2R)-1-phenylmethoxy-3-[(2S,3R)-3-(phenylsulfanylmethyl)oxiran-2-yl]propan-2-ol (PubChem CID 10860500) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is (2R)-1-phenylmethoxy-3-[(2S,3R)-3-(phenylsulfanylmethyl)oxiran-2-yl]propan-2-ol.
| Compound Name | (2R)-1-phenylmethoxy-3-[(2S,3R)-3-(phenylsulfanylmethyl)oxiran-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 10860500 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (2R)-1-phenylmethoxy-3-[(2S,3R)-3-(phenylsulfanylmethyl)oxiran-2-yl]propan-2-ol |
| SMILES | O[C@@H](COCc1ccccc1)C[C@@H]1O[C@H]1CSc1ccccc1 |
| InChI | InChI=1S/C19H22O3S/c20-16(13-21-12-15-7-3-1-4-8-15)11-18-19(22-18)14-23-17-9-5-2-6-10-17/h1-10,16,18-20H,11-14H2/t16-,18+,19+/m1/s1 |
| InChIKey | FSMWWKOBFUYHSE-NEWSRXKRSA-N |
| XLogP | 3.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|