C24H42O5Si — CID 11453443
(2R)-1-[(2R,3R,4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,5-dimethyloxan-2-yl]-3-phenylmethoxypropan-2-ol (PubChem CID 11453443) has the molecular formula C24H42O5Si and a molecular weight of 438.68 g/mol. Its IUPAC name is (2R)-1-[(2R,3R,4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,5-dimethyloxan-2-yl]-3-phenylmethoxypropan-2-ol.
| Compound Name | (2R)-1-[(2R,3R,4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,5-dimethyloxan-2-yl]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 11453443 |
| Molecular Formula | C24H42O5Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (2R)-1-[(2R,3R,4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,5-dimethyloxan-2-yl]-3-phenylmethoxypropan-2-ol |
| SMILES | CO[C@@H]1O[C@H](C[C@@H](O)COCc2ccccc2)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C24H42O5Si/c1-17-21(14-20(25)16-27-15-19-12-10-9-11-13-19)28-23(26-6)18(2)22(17)29-30(7,8)24(3,4)5/h9-13,17-18,20-23,25H,14-16H2,1-8H3/t17-,18+,20-,21-,22-,23-/m1/s1 |
| InChIKey | AFKRKPNBMGWESP-XSQFVWFVSA-N |
| XLogP | 4.99 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|