C40H56O8Si — CID 10919538
tert-butyl-[(2S,3S,6S)-6-[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-2-methyloxan-3-yl]oxy-dimethylsilane (PubChem CID 10919538) has the molecular formula C40H56O8Si and a molecular weight of 692.97 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,6S)-6-[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-2-methyloxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3S,6S)-6-[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-2-methyloxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10919538 |
| Molecular Formula | C40H56O8Si |
| Molecular Weight | 692.97 g/mol |
| Exact Mass | 692.37 |
| IUPAC Name | tert-butyl-[(2S,3S,6S)-6-[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl]oxy-2-methyloxan-3-yl]oxy-dimethylsilane |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@@H](O[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)O2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C40H56O8Si/c1-29-33(48-49(6,7)40(2,3)4)23-24-35(45-29)47-36-34(28-42-25-30-17-11-8-12-18-30)46-39(41-5)38(44-27-32-21-15-10-16-22-32)37(36)43-26-31-19-13-9-14-20-31/h8-22,29,33-39H,23-28H2,1-7H3/t29-,33-,34+,35-,36+,37-,38+,39-/m0/s1 |
| InChIKey | RUHWDOMWEFNVNJ-AOEVQXAJSA-N |
| XLogP | 8.05 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.97 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|