C19H32O4Si — CID 11348751
(E,2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxyhex-4-ene-2,3-diol (PubChem CID 11348751) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is (E,2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxyhex-4-ene-2,3-diol.
| Compound Name | (E,2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxyhex-4-ene-2,3-diol |
|---|---|
| PubChem CID | 11348751 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (E,2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxyhex-4-ene-2,3-diol |
| SMILES | C/C(=C\[C@@H](O)[C@H](O)COCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O4Si/c1-15(23-24(5,6)19(2,3)4)12-17(20)18(21)14-22-13-16-10-8-7-9-11-16/h7-12,17-18,20-21H,13-14H2,1-6H3/b15-12+/t17-,18-/m1/s1 |
| InChIKey | COBJIHVKFUKPGK-HRSGCLKMSA-N |
| XLogP | 3.85 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|