C32H58O4Si — CID 164887777
(E,4S,6R,9S,10R,11S)-11-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-2,2,4,6,8,10-hexamethyl-12-phenylmethoxydodec-7-en-3-ol (PubChem CID 164887777) has the molecular formula C32H58O4Si and a molecular weight of 534.90 g/mol. Its IUPAC name is (E,4S,6R,9S,10R,11S)-11-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-2,2,4,6,8,10-hexamethyl-12-phenylmethoxydodec-7-en-3-ol.
| Compound Name | (E,4S,6R,9S,10R,11S)-11-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-2,2,4,6,8,10-hexamethyl-12-phenylmethoxydodec-7-en-3-ol |
|---|---|
| PubChem CID | 164887777 |
| Molecular Formula | C32H58O4Si |
| Molecular Weight | 534.90 g/mol |
| Exact Mass | 534.41 |
| IUPAC Name | (E,4S,6R,9S,10R,11S)-11-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-2,2,4,6,8,10-hexamethyl-12-phenylmethoxydodec-7-en-3-ol |
| SMILES | CO[C@H](/C(C)=C/[C@H](C)C[C@H](C)C(O)C(C)(C)C)[C@@H](C)[C@@H](COCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H58O4Si/c1-23(20-25(3)30(33)31(5,6)7)19-24(2)29(34-11)26(4)28(36-37(12,13)32(8,9)10)22-35-21-27-17-15-14-16-18-27/h14-19,23,25-26,28-30,33H,20-22H2,1-13H3/b24-19+/t23-,25-,26-,28+,29+,30?/m0/s1 |
| InChIKey | ACFRKHRWEQSPIW-PBBDAZDUSA-N |
| XLogP | 8.26 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.90 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|