C29H55NO5Si — CID 174039793
(2R,3R,8S,9S)-8-amino-11-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-2,4-dimethyl-1-phenylmethoxytridecane-3,5-diol (PubChem CID 174039793) has the molecular formula C29H55NO5Si and a molecular weight of 525.85 g/mol. Its IUPAC name is (2R,3R,8S,9S)-8-amino-11-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-2,4-dimethyl-1-phenylmethoxytridecane-3,5-diol.
| Compound Name | (2R,3R,8S,9S)-8-amino-11-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-2,4-dimethyl-1-phenylmethoxytridecane-3,5-diol |
|---|---|
| PubChem CID | 174039793 |
| Molecular Formula | C29H55NO5Si |
| Molecular Weight | 525.85 g/mol |
| Exact Mass | 525.38 |
| IUPAC Name | (2R,3R,8S,9S)-8-amino-11-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-2,4-dimethyl-1-phenylmethoxytridecane-3,5-diol |
| SMILES | CCC(C[C@H](OC)[C@@H](N)CCC(O)C(C)[C@H](O)[C@H](C)COCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H55NO5Si/c1-10-24(35-36(8,9)29(4,5)6)18-27(33-7)25(30)16-17-26(31)22(3)28(32)21(2)19-34-20-23-14-12-11-13-15-23/h11-15,21-22,24-28,31-32H,10,16-20,30H2,1-9H3/t21-,22?,24?,25+,26?,27+,28-/m1/s1 |
| InChIKey | BPQTWVUMSYFFBM-WOWGTZKDSA-N |
| XLogP | 5.51 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.85 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|