C39H72O5Si2 — CID 101494848
(3R,4E,6S,8R,10S,12S)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methoxy-5,11,11-trimethyl-3-(phenylmethoxymethyl)pentadeca-4,14-dien-6-ol (PubChem CID 101494848) has the molecular formula C39H72O5Si2 and a molecular weight of 677.17 g/mol. Its IUPAC name is (3R,4E,6S,8R,10S,12S)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methoxy-5,11,11-trimethyl-3-(phenylmethoxymethyl)pentadeca-4,14-dien-6-ol.
| Compound Name | (3R,4E,6S,8R,10S,12S)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methoxy-5,11,11-trimethyl-3-(phenylmethoxymethyl)pentadeca-4,14-dien-6-ol |
|---|---|
| PubChem CID | 101494848 |
| Molecular Formula | C39H72O5Si2 |
| Molecular Weight | 677.17 g/mol |
| Exact Mass | 676.49 |
| IUPAC Name | (3R,4E,6S,8R,10S,12S)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methoxy-5,11,11-trimethyl-3-(phenylmethoxymethyl)pentadeca-4,14-dien-6-ol |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H](C[C@@H](C[C@H](O)/C(C)=C/[C@@H](CC)COCc1ccccc1)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H72O5Si2/c1-17-22-35(43-45(13,14)37(4,5)6)39(10,11)36(44-46(15,16)38(7,8)9)27-33(41-12)26-34(40)30(3)25-31(18-2)28-42-29-32-23-20-19-21-24-32/h17,19-21,23-25,31,33-36,40H,1,18,22,26-29H2,2-16H3/b30-25+/t31-,33-,34+,35+,36+/m1/s1 |
| InChIKey | VZSWEXGHWRONER-ACNHLIECSA-N |
| XLogP | 10.71 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.17 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|