C25H52O4Si2 — CID 101494851
(3S,5S,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-6,6-dimethyldec-9-enal (PubChem CID 101494851) has the molecular formula C25H52O4Si2 and a molecular weight of 472.86 g/mol. Its IUPAC name is (3S,5S,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-6,6-dimethyldec-9-enal.
| Compound Name | (3S,5S,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-6,6-dimethyldec-9-enal |
|---|---|
| PubChem CID | 101494851 |
| Molecular Formula | C25H52O4Si2 |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | (3S,5S,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-6,6-dimethyldec-9-enal |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H](C[C@@H](CC=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O4Si2/c1-15-16-21(28-30(11,12)23(2,3)4)25(8,9)22(19-20(27-10)17-18-26)29-31(13,14)24(5,6)7/h15,18,20-22H,1,16-17,19H2,2-14H3/t20-,21+,22+/m1/s1 |
| InChIKey | CUXJYMYIHNXURV-FSSWDIPSSA-N |
| XLogP | 7.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|