C12H25IOSi — CID 102090847
tert-butyl-[(2S,3R)-2-iodohex-5-en-3-yl]oxy-dimethylsilane (PubChem CID 102090847) has the molecular formula C12H25IOSi and a molecular weight of 340.32 g/mol. Its IUPAC name is tert-butyl-[(2S,3R)-2-iodohex-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R)-2-iodohex-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102090847 |
| Molecular Formula | C12H25IOSi |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | tert-butyl-[(2S,3R)-2-iodohex-5-en-3-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)I |
| InChI | InChI=1S/C12H25IOSi/c1-8-9-11(10(2)13)14-15(6,7)12(3,4)5/h8,10-11H,1,9H2,2-7H3/t10-,11+/m0/s1 |
| InChIKey | PRPSHHZORYPCFG-WDEREUQCSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|