C16H33IOSi — CID 10524787
tert-butyl-[(2S,3S,6S)-1-iodo-2,6-dimethyloct-7-en-3-yl]oxy-dimethylsilane (PubChem CID 10524787) has the molecular formula C16H33IOSi and a molecular weight of 396.43 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,6S)-1-iodo-2,6-dimethyloct-7-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3S,6S)-1-iodo-2,6-dimethyloct-7-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10524787 |
| Molecular Formula | C16H33IOSi |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | tert-butyl-[(2S,3S,6S)-1-iodo-2,6-dimethyloct-7-en-3-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@H](C)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CI |
| InChI | InChI=1S/C16H33IOSi/c1-9-13(2)10-11-15(14(3)12-17)18-19(7,8)16(4,5)6/h9,13-15H,1,10-12H2,2-8H3/t13-,14-,15+/m1/s1 |
| InChIKey | ZCCFOUUOKPALQY-KFWWJZLASA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|