C18H39IO3Si2 — CID 71819486
(2R,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-iodohex-5-en-2-ol (PubChem CID 71819486) has the molecular formula C18H39IO3Si2 and a molecular weight of 486.58 g/mol. Its IUPAC name is (2R,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-iodohex-5-en-2-ol.
| Compound Name | (2R,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-iodohex-5-en-2-ol |
|---|---|
| PubChem CID | 71819486 |
| Molecular Formula | C18H39IO3Si2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | (2R,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-iodohex-5-en-2-ol |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)CI |
| InChI | InChI=1S/C18H39IO3Si2/c1-12-15(21-23(8,9)17(2,3)4)16(14(20)13-19)22-24(10,11)18(5,6)7/h12,14-16,20H,1,13H2,2-11H3/t14-,15+,16+/m0/s1 |
| InChIKey | OGKXUFNGMMAUOQ-ARFHVFGLSA-N |
| XLogP | 5.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|