C14H28O2Si — CID 10515260
(3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhex-5-en-1-ol (PubChem CID 10515260) has the molecular formula C14H28O2Si and a molecular weight of 256.46 g/mol. Its IUPAC name is (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhex-5-en-1-ol.
| Compound Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhex-5-en-1-ol |
|---|---|
| PubChem CID | 10515260 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhex-5-en-1-ol |
| SMILES | C=C[C@H](CCO)[C@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O2Si/c1-8-12(10-11-15)13(9-2)16-17(6,7)14(3,4)5/h8-9,12-13,15H,1-2,10-11H2,3-7H3/t12-,13+/m1/s1 |
| InChIKey | IUFOXOUOAXMJIX-OLZOCXBDSA-N |
| XLogP | 3.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|