C13H27IO2Si — CID 102090845
(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-iodohept-6-en-1-ol (PubChem CID 102090845) has the molecular formula C13H27IO2Si and a molecular weight of 370.35 g/mol. Its IUPAC name is (3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-iodohept-6-en-1-ol.
| Compound Name | (3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-iodohept-6-en-1-ol |
|---|---|
| PubChem CID | 102090845 |
| Molecular Formula | C13H27IO2Si |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | (3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-iodohept-6-en-1-ol |
| SMILES | C=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](I)CCO |
| InChI | InChI=1S/C13H27IO2Si/c1-7-8-12(11(14)9-10-15)16-17(5,6)13(2,3)4/h7,11-12,15H,1,8-10H2,2-6H3/t11-,12+/m0/s1 |
| InChIKey | TXSYFMCDSZSYHZ-NWDGAFQWSA-N |
| XLogP | 4.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|