C22H36O2Si — CID 102186252
[2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol (PubChem CID 102186252) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol.
| Compound Name | [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol |
|---|---|
| PubChem CID | 102186252 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=C)CCc1ccccc1CO |
| InChI | InChI=1S/C22H36O2Si/c1-8-12-21(24-25(6,7)22(3,4)5)18(9-2)15-16-19-13-10-11-14-20(19)17-23/h8-11,13-14,18,21,23H,1-2,12,15-17H2,3-7H3/t18-,21-/m0/s1 |
| InChIKey | HTFJFAPCBNXYFA-RXVVDRJESA-N |
| XLogP | 5.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|