About [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol
[2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol (PubChem CID 102186252) has the molecular formula C22H36O2Si
and a molecular weight of 360.61 g/mol. Its IUPAC name is [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol.
Molecular Properties
| Compound Name | [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol |
| PubChem CID | 102186252 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=C)CCc1ccccc1CO |
| InChI | InChI=1S/C22H36O2Si/c1-8-12-21(24-25(6,7)22(3,4)5)18(9-2)15-16-19-13-10-11-14-20(19)17-23/h8-11,13-14,18,21,23H,1-2,12,15-17H2,3-7H3/t18-,21-/m0/s1 |
| InChIKey | HTFJFAPCBNXYFA-RXVVDRJESA-N |
| XLogP | 5.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol?
The IUPAC name of [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol (CID 102186252) is [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol.
What is the SMILES notation for [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol?
The canonical SMILES for [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol is C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=C)CCc1ccccc1CO.
What is the InChIKey of [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol?
The InChIKey is HTFJFAPCBNXYFA-RXVVDRJESA-N. The full InChI is InChI=1S/C22H36O2Si/c1-8-12-21(24-25(6,7)22(3,4)5)18(9-2)15-16-19-13-10-11-14-20(19)17-23/h8-11,13-14,18,21,23H,1-2,12,15-17H2,3-7H3/t18-,21-/m0/s1.
What are the key properties of [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol?
[2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol has a molecular weight of 360.61 g/mol, XLogP of 5.88, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethenylhept-6-enyl]phenyl]methanol is sourced from PubChem (CID 102186252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).