C25H34O2Si — CID 134979384
(2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-3-(2-phenylethyl)pent-4-en-1-one (PubChem CID 134979384) has the molecular formula C25H34O2Si and a molecular weight of 394.63 g/mol. Its IUPAC name is (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-3-(2-phenylethyl)pent-4-en-1-one.
| Compound Name | (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-3-(2-phenylethyl)pent-4-en-1-one |
|---|---|
| PubChem CID | 134979384 |
| Molecular Formula | C25H34O2Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-3-(2-phenylethyl)pent-4-en-1-one |
| SMILES | C=C[C@H](CCc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H34O2Si/c1-7-21(19-18-20-14-10-8-11-15-20)24(27-28(5,6)25(2,3)4)23(26)22-16-12-9-13-17-22/h7-17,21,24H,1,18-19H2,2-6H3/t21-,24+/m1/s1 |
| InChIKey | PCGIMHIMLULLNM-QPPBQGQZSA-N |
| XLogP | 6.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|