C27H49NO4Si2 — CID 11134977
(2S,3R,4S)-N-benzyl-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxyoct-7-enamide (PubChem CID 11134977) has the molecular formula C27H49NO4Si2 and a molecular weight of 507.86 g/mol. Its IUPAC name is (2S,3R,4S)-N-benzyl-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxyoct-7-enamide.
| Compound Name | (2S,3R,4S)-N-benzyl-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxyoct-7-enamide |
|---|---|
| PubChem CID | 11134977 |
| Molecular Formula | C27H49NO4Si2 |
| Molecular Weight | 507.86 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | (2S,3R,4S)-N-benzyl-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxyoct-7-enamide |
| SMILES | C=CCC[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H49NO4Si2/c1-12-13-19-22(29)23(31-33(8,9)26(2,3)4)24(32-34(10,11)27(5,6)7)25(30)28-20-21-17-15-14-16-18-21/h12,14-18,22-24,29H,1,13,19-20H2,2-11H3,(H,28,30)/t22-,23+,24-/m0/s1 |
| InChIKey | WXINKXZHDFRDSM-VXNXHJTFSA-N |
| XLogP | 6.41 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.86 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|