C22H29FN2O4Si — CID 102533772
(2S,3S)-N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-3-(4-nitrophenyl)propanamide (PubChem CID 102533772) has the molecular formula C22H29FN2O4Si and a molecular weight of 432.57 g/mol. Its IUPAC name is (2S,3S)-N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-3-(4-nitrophenyl)propanamide.
| Compound Name | (2S,3S)-N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-3-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 102533772 |
| Molecular Formula | C22H29FN2O4Si |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (2S,3S)-N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-3-(4-nitrophenyl)propanamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](c1ccc([N+](=O)[O-])cc1)[C@H](F)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H29FN2O4Si/c1-22(2,3)30(4,5)29-20(17-11-13-18(14-12-17)25(27)28)19(23)21(26)24-15-16-9-7-6-8-10-16/h6-14,19-20H,15H2,1-5H3,(H,24,26)/t19-,20-/m0/s1 |
| InChIKey | NCGJEXZSVLVMHL-PMACEKPBSA-N |
| XLogP | 5.31 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|