C38H57NO6Si2 — CID 134865836
(2R,3S,4R)-N-benzyl-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-5-(3-methoxy-4-phenylmethoxyphenyl)pentanamide (PubChem CID 134865836) has the molecular formula C38H57NO6Si2 and a molecular weight of 680.05 g/mol. Its IUPAC name is (2R,3S,4R)-N-benzyl-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-5-(3-methoxy-4-phenylmethoxyphenyl)pentanamide.
| Compound Name | (2R,3S,4R)-N-benzyl-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-5-(3-methoxy-4-phenylmethoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 134865836 |
| Molecular Formula | C38H57NO6Si2 |
| Molecular Weight | 680.05 g/mol |
| Exact Mass | 679.37 |
| IUPAC Name | (2R,3S,4R)-N-benzyl-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-5-(3-methoxy-4-phenylmethoxyphenyl)pentanamide |
| SMILES | COc1cc(C[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)NCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C38H57NO6Si2/c1-37(2,3)46(8,9)44-34(35(45-47(10,11)38(4,5)6)36(41)39-26-28-18-14-12-15-19-28)31(40)24-30-22-23-32(33(25-30)42-7)43-27-29-20-16-13-17-21-29/h12-23,25,31,34-35,40H,24,26-27H2,1-11H3,(H,39,41)/t31-,34+,35-/m1/s1 |
| InChIKey | QENQRZHWGZPDFW-ZCLHRBOTSA-N |
| XLogP | 8.27 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.05 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|