C18H29ClO2Si — CID 134851798
(1S,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-1-chloro-1-phenylhex-5-en-3-ol (PubChem CID 134851798) has the molecular formula C18H29ClO2Si and a molecular weight of 340.97 g/mol. Its IUPAC name is (1S,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-1-chloro-1-phenylhex-5-en-3-ol.
| Compound Name | (1S,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-1-chloro-1-phenylhex-5-en-3-ol |
|---|---|
| PubChem CID | 134851798 |
| Molecular Formula | C18H29ClO2Si |
| Molecular Weight | 340.97 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (1S,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-1-chloro-1-phenylhex-5-en-3-ol |
| SMILES | C=CC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](Cl)c1ccccc1 |
| InChI | InChI=1S/C18H29ClO2Si/c1-7-11-15(20)17(21-22(5,6)18(2,3)4)16(19)14-12-9-8-10-13-14/h7-10,12-13,15-17,20H,1,11H2,2-6H3/t15-,16+,17-/m1/s1 |
| InChIKey | PCWRMWMDVVBYPD-IXDOHACOSA-N |
| XLogP | 5.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.97 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|