C20H34O4Si — CID 102042788
(4S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(4-methoxyphenoxy)hept-1-en-4-ol (PubChem CID 102042788) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is (4S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(4-methoxyphenoxy)hept-1-en-4-ol.
| Compound Name | (4S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(4-methoxyphenoxy)hept-1-en-4-ol |
|---|---|
| PubChem CID | 102042788 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (4S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-(4-methoxyphenoxy)hept-1-en-4-ol |
| SMILES | C=CC[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H34O4Si/c1-9-10-18(21)19(24-25(7,8)20(3,4)5)15(2)23-17-13-11-16(22-6)12-14-17/h9,11-15,18-19,21H,1,10H2,2-8H3/t15-,18-,19+/m0/s1 |
| InChIKey | FHLCNLIXZMNHCS-ZYSHUDEJSA-N |
| XLogP | 4.79 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|