About N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline
N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline (PubChem CID 135014872) has the molecular formula C18H31NO2Si
and a molecular weight of 321.54 g/mol. Its IUPAC name is N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline.
Molecular Properties
| Compound Name | N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline |
| PubChem CID | 135014872 |
| Molecular Formula | C18H31NO2Si |
| Molecular Weight | 321.54 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline |
| SMILES | C=C[C@@H](Nc1ccc(OC)cc1)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H31NO2Si/c1-9-17(14(2)21-22(7,8)18(3,4)5)19-15-10-12-16(20-6)13-11-15/h9-14,17,19H,1H2,2-8H3/t14-,17+/m0/s1 |
| InChIKey | MEAZVBUEVPVURU-WMLDXEAASA-N |
| XLogP | 5.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline?
The IUPAC name of N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline (CID 135014872) is N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline.
What is the SMILES notation for N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline?
The canonical SMILES for N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline is C=C[C@@H](Nc1ccc(OC)cc1)[C@H](C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline?
The InChIKey is MEAZVBUEVPVURU-WMLDXEAASA-N. The full InChI is InChI=1S/C18H31NO2Si/c1-9-17(14(2)21-22(7,8)18(3,4)5)19-15-10-12-16(20-6)13-11-15/h9-14,17,19H,1H2,2-8H3/t14-,17+/m0/s1.
What are the key properties of N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline?
N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline has a molecular weight of 321.54 g/mol, XLogP of 5.07, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-4-methoxyaniline is sourced from PubChem (CID 135014872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).