C19H33NO3Si — CID 135014871
N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-2,4-dimethoxyaniline (PubChem CID 135014871) has the molecular formula C19H33NO3Si and a molecular weight of 351.56 g/mol. Its IUPAC name is N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-2,4-dimethoxyaniline.
| Compound Name | N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-2,4-dimethoxyaniline |
|---|---|
| PubChem CID | 135014871 |
| Molecular Formula | C19H33NO3Si |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl]-2,4-dimethoxyaniline |
| SMILES | C=C[C@@H](Nc1ccc(OC)cc1OC)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H33NO3Si/c1-10-16(14(2)23-24(8,9)19(3,4)5)20-17-12-11-15(21-6)13-18(17)22-7/h10-14,16,20H,1H2,2-9H3/t14-,16+/m0/s1 |
| InChIKey | WQQPRUMRBOHYJN-GOEBONIOSA-N |
| XLogP | 5.08 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|