C18H23NO2 — CID 43191590
N-[1-(2,4-dimethylphenyl)ethyl]-2,4-dimethoxyaniline (PubChem CID 43191590) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenyl)ethyl]-2,4-dimethoxyaniline.
| Compound Name | N-[1-(2,4-dimethylphenyl)ethyl]-2,4-dimethoxyaniline |
|---|---|
| PubChem CID | 43191590 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-[1-(2,4-dimethylphenyl)ethyl]-2,4-dimethoxyaniline |
| SMILES | COc1ccc(NC(C)c2ccc(C)cc2C)c(OC)c1 |
| InChI | InChI=1S/C18H23NO2/c1-12-6-8-16(13(2)10-12)14(3)19-17-9-7-15(20-4)11-18(17)21-5/h6-11,14,19H,1-5H3 |
| InChIKey | YCKGHNRACPITPS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|