C19H24N2O2S — CID 2207743
1-(2,4-dimethoxyphenyl)-3-[(1S)-1-(2,5-dimethylphenyl)ethyl]thiourea (PubChem CID 2207743) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[(1S)-1-(2,5-dimethylphenyl)ethyl]thiourea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[(1S)-1-(2,5-dimethylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 2207743 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[(1S)-1-(2,5-dimethylphenyl)ethyl]thiourea |
| SMILES | COc1ccc(NC(=S)N[C@@H](C)c2cc(C)ccc2C)c(OC)c1 |
| InChI | InChI=1S/C19H24N2O2S/c1-12-6-7-13(2)16(10-12)14(3)20-19(24)21-17-9-8-15(22-4)11-18(17)23-5/h6-11,14H,1-5H3,(H2,20,21,24)/t14-/m0/s1 |
| InChIKey | AXJXSLPOQKYZRV-AWEZNQCLSA-N |
| XLogP | 4.37 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|