C22H28N2OS — CID 100670837
1-(4-cyclopentyloxyphenyl)-3-[(1S)-1-(2,5-dimethylphenyl)ethyl]thiourea (PubChem CID 100670837) has the molecular formula C22H28N2OS and a molecular weight of 368.55 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-3-[(1S)-1-(2,5-dimethylphenyl)ethyl]thiourea.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-3-[(1S)-1-(2,5-dimethylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 100670837 |
| Molecular Formula | C22H28N2OS |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-3-[(1S)-1-(2,5-dimethylphenyl)ethyl]thiourea |
| SMILES | Cc1ccc(C)c([C@H](C)NC(=S)Nc2ccc(OC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C22H28N2OS/c1-15-8-9-16(2)21(14-15)17(3)23-22(26)24-18-10-12-20(13-11-18)25-19-6-4-5-7-19/h8-14,17,19H,4-7H2,1-3H3,(H2,23,24,26)/t17-/m0/s1 |
| InChIKey | FHVTYGVVCJKVTM-KRWDZBQOSA-N |
| XLogP | 5.67 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|