C20H23NO2 — CID 38454818
N-(4-cyclopentyloxyphenyl)-2,5-dimethylbenzamide (PubChem CID 38454818) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-(4-cyclopentyloxyphenyl)-2,5-dimethylbenzamide.
| Compound Name | N-(4-cyclopentyloxyphenyl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 38454818 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-(4-cyclopentyloxyphenyl)-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)Nc2ccc(OC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C20H23NO2/c1-14-7-8-15(2)19(13-14)20(22)21-16-9-11-18(12-10-16)23-17-5-3-4-6-17/h7-13,17H,3-6H2,1-2H3,(H,21,22) |
| InChIKey | FIQNTGSHNBPAII-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |