C19H21NO2S — CID 39100305
4-cyclopentyloxy-N-(4-methylsulfanylphenyl)benzamide (PubChem CID 39100305) has the molecular formula C19H21NO2S and a molecular weight of 327.45 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-(4-methylsulfanylphenyl)benzamide.
| Compound Name | 4-cyclopentyloxy-N-(4-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 39100305 |
| Molecular Formula | C19H21NO2S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-cyclopentyloxy-N-(4-methylsulfanylphenyl)benzamide |
| SMILES | CSc1ccc(NC(=O)c2ccc(OC3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C19H21NO2S/c1-23-18-12-8-15(9-13-18)20-19(21)14-6-10-17(11-7-14)22-16-4-2-3-5-16/h6-13,16H,2-5H2,1H3,(H,20,21) |
| InChIKey | MXSCYWJGJVKGOR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |